C27H28N2O7 — CID 43954610
dimethyl 2-[(1-benzyl-5-ethoxycarbonyl-2,4-dimethylpyrrole-3-carbonyl)amino]benzene-1,4-dicarboxylate (PubChem CID 43954610) has the molecular formula C27H28N2O7 and a molecular weight of 492.53 g/mol. Its IUPAC name is dimethyl 2-[(1-benzyl-5-ethoxycarbonyl-2,4-dimethylpyrrole-3-carbonyl)amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[(1-benzyl-5-ethoxycarbonyl-2,4-dimethylpyrrole-3-carbonyl)amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 43954610 |
| Molecular Formula | C27H28N2O7 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | dimethyl 2-[(1-benzyl-5-ethoxycarbonyl-2,4-dimethylpyrrole-3-carbonyl)amino]benzene-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)c(C(=O)Nc2cc(C(=O)OC)ccc2C(=O)OC)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C27H28N2O7/c1-6-36-27(33)23-16(2)22(17(3)29(23)15-18-10-8-7-9-11-18)24(30)28-21-14-19(25(31)34-4)12-13-20(21)26(32)35-5/h7-14H,6,15H2,1-5H3,(H,28,30) |
| InChIKey | FZPMCWHKJRLVPV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|