C23H28N4O3 — CID 43954500
ethyl 1-benzyl-4-(3-imidazol-1-ylpropylcarbamoyl)-3,5-dimethylpyrrole-2-carboxylate (PubChem CID 43954500) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is ethyl 1-benzyl-4-(3-imidazol-1-ylpropylcarbamoyl)-3,5-dimethylpyrrole-2-carboxylate.
| Compound Name | ethyl 1-benzyl-4-(3-imidazol-1-ylpropylcarbamoyl)-3,5-dimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 43954500 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | ethyl 1-benzyl-4-(3-imidazol-1-ylpropylcarbamoyl)-3,5-dimethylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(C)c(C(=O)NCCCn2ccnc2)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C23H28N4O3/c1-4-30-23(29)21-17(2)20(18(3)27(21)15-19-9-6-5-7-10-19)22(28)25-11-8-13-26-14-12-24-16-26/h5-7,9-10,12,14,16H,4,8,11,13,15H2,1-3H3,(H,25,28) |
| InChIKey | DZOHFSQJZJJYBT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|