C16H23NO4S — CID 59373721
3-O-tert-butyl 6-O-ethyl 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3,6-dicarboxylate (PubChem CID 59373721) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is 3-O-tert-butyl 6-O-ethyl 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3,6-dicarboxylate.
| Compound Name | 3-O-tert-butyl 6-O-ethyl 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3,6-dicarboxylate |
|---|---|
| PubChem CID | 59373721 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-O-tert-butyl 6-O-ethyl 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1CCc2c(sc(N)c2C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H23NO4S/c1-5-20-14(18)9-6-7-10-11(8-9)22-13(17)12(10)15(19)21-16(2,3)4/h9H,5-8,17H2,1-4H3 |
| InChIKey | GPLXRUZYDDVFEO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|