C16H21NO7S — CID 86759953
2-O-[[2-amino-3-[(2-methylpropan-2-yl)oxycarbonyl]-5,7-dihydro-4H-thieno[2,3-c]pyran-5-yl]methyl] 1-O-methyl oxalate (PubChem CID 86759953) has the molecular formula C16H21NO7S and a molecular weight of 371.41 g/mol. Its IUPAC name is 2-O-[[2-amino-3-[(2-methylpropan-2-yl)oxycarbonyl]-5,7-dihydro-4H-thieno[2,3-c]pyran-5-yl]methyl] 1-O-methyl oxalate.
| Compound Name | 2-O-[[2-amino-3-[(2-methylpropan-2-yl)oxycarbonyl]-5,7-dihydro-4H-thieno[2,3-c]pyran-5-yl]methyl] 1-O-methyl oxalate |
|---|---|
| PubChem CID | 86759953 |
| Molecular Formula | C16H21NO7S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-O-[[2-amino-3-[(2-methylpropan-2-yl)oxycarbonyl]-5,7-dihydro-4H-thieno[2,3-c]pyran-5-yl]methyl] 1-O-methyl oxalate |
| SMILES | COC(=O)C(=O)OCC1Cc2c(sc(N)c2C(=O)OC(C)(C)C)CO1 |
| InChI | InChI=1S/C16H21NO7S/c1-16(2,3)24-13(18)11-9-5-8(6-23-15(20)14(19)21-4)22-7-10(9)25-12(11)17/h8H,5-7,17H2,1-4H3 |
| InChIKey | ZMMYVQXXCCYFJM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|