C11H13NO4S — CID 163298796
dimethyl 2-amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3,5-dicarboxylate (PubChem CID 163298796) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is dimethyl 2-amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3,5-dicarboxylate.
| Compound Name | dimethyl 2-amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3,5-dicarboxylate |
|---|---|
| PubChem CID | 163298796 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | dimethyl 2-amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3,5-dicarboxylate |
| SMILES | COC(=O)c1c(N)sc2c1CC(C(=O)OC)C2 |
| InChI | InChI=1S/C11H13NO4S/c1-15-10(13)5-3-6-7(4-5)17-9(12)8(6)11(14)16-2/h5H,3-4,12H2,1-2H3 |
| InChIKey | LWWURFHNFQDBGU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|