C9H13N2O2S+ — CID 8934592
methyl 2-amino-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate (PubChem CID 8934592) has the molecular formula C9H13N2O2S+ and a molecular weight of 213.28 g/mol. Its IUPAC name is methyl 2-amino-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate.
| Compound Name | methyl 2-amino-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
|---|---|
| PubChem CID | 8934592 |
| Molecular Formula | C9H13N2O2S+ |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | methyl 2-amino-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
| SMILES | COC(=O)c1c(N)sc2c1CC[NH2+]C2 |
| InChI | InChI=1S/C9H12N2O2S/c1-13-9(12)7-5-2-3-11-4-6(5)14-8(7)10/h11H,2-4,10H2,1H3/p+1 |
| InChIKey | LQZANZIKFLNHAS-UHFFFAOYSA-O |
| XLogP | -0.26 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|