C14H18O5S2 — CID 175947716
dimethyl 2-(2-methoxyethylsulfanyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3,5-dicarboxylate (PubChem CID 175947716) has the molecular formula C14H18O5S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is dimethyl 2-(2-methoxyethylsulfanyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3,5-dicarboxylate.
| Compound Name | dimethyl 2-(2-methoxyethylsulfanyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3,5-dicarboxylate |
|---|---|
| PubChem CID | 175947716 |
| Molecular Formula | C14H18O5S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | dimethyl 2-(2-methoxyethylsulfanyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3,5-dicarboxylate |
| SMILES | COCCSc1sc2c(c1C(=O)OC)CC(C(=O)OC)C2 |
| InChI | InChI=1S/C14H18O5S2/c1-17-4-5-20-14-11(13(16)19-3)9-6-8(12(15)18-2)7-10(9)21-14/h8H,4-7H2,1-3H3 |
| InChIKey | ISPDYUBVYOEGDL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|