C30H40N2O6S2 — CID 4059658
methyl 6-ethyl-2-[[6-[(6-ethyl-3-methoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-6-oxohexanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4059658) has the molecular formula C30H40N2O6S2 and a molecular weight of 588.79 g/mol. Its IUPAC name is methyl 6-ethyl-2-[[6-[(6-ethyl-3-methoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-6-oxohexanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 6-ethyl-2-[[6-[(6-ethyl-3-methoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-6-oxohexanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4059658 |
| Molecular Formula | C30H40N2O6S2 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | methyl 6-ethyl-2-[[6-[(6-ethyl-3-methoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-6-oxohexanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCC1CCc2c(sc(NC(=O)CCCCC(=O)Nc3sc4c(c3C(=O)OC)CCC(CC)C4)c2C(=O)OC)C1 |
| InChI | InChI=1S/C30H40N2O6S2/c1-5-17-11-13-19-21(15-17)39-27(25(19)29(35)37-3)31-23(33)9-7-8-10-24(34)32-28-26(30(36)38-4)20-14-12-18(6-2)16-22(20)40-28/h17-18H,5-16H2,1-4H3,(H,31,33)(H,32,34) |
| InChIKey | HNTRRFCZERYVEM-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|