C19H27NO5S — CID 92757333
ethyl (6R)-2-[(4-ethoxy-4-oxobutanoyl)amino]-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 92757333) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is ethyl (6R)-2-[(4-ethoxy-4-oxobutanoyl)amino]-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl (6R)-2-[(4-ethoxy-4-oxobutanoyl)amino]-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 92757333 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | ethyl (6R)-2-[(4-ethoxy-4-oxobutanoyl)amino]-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)CCC(=O)Nc1sc2c(c1C(=O)OCC)CC[C@@H](CC)C2 |
| InChI | InChI=1S/C19H27NO5S/c1-4-12-7-8-13-14(11-12)26-18(17(13)19(23)25-6-3)20-15(21)9-10-16(22)24-5-2/h12H,4-11H2,1-3H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | MBHHABYHJNLYCS-GFCCVEGCSA-N |
| XLogP | 3.72 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'} |
|---|