C19H21NO4S — CID 167675496
methyl 2-amino-5-(2-oxo-2-phenylmethoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 167675496) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is methyl 2-amino-5-(2-oxo-2-phenylmethoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-amino-5-(2-oxo-2-phenylmethoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 167675496 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | methyl 2-amino-5-(2-oxo-2-phenylmethoxyethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N)sc2c1CC(CC(=O)OCc1ccccc1)CC2 |
| InChI | InChI=1S/C19H21NO4S/c1-23-19(22)17-14-9-13(7-8-15(14)25-18(17)20)10-16(21)24-11-12-5-3-2-4-6-12/h2-6,13H,7-11,20H2,1H3 |
| InChIKey | UTENHJDTUNSPGQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|