C32H44N4O6S2 — CID 167706585
ethyl 2-amino-3-(cyclopropylmethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxylate;ethyl 2-amino-3-(cyclopropylmethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophene-7-carboxylate (PubChem CID 167706585) has the molecular formula C32H44N4O6S2 and a molecular weight of 644.86 g/mol. Its IUPAC name is ethyl 2-amino-3-(cyclopropylmethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxylate;ethyl 2-amino-3-(cyclopropylmethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophene-7-carboxylate.
| Compound Name | ethyl 2-amino-3-(cyclopropylmethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxylate;ethyl 2-amino-3-(cyclopropylmethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophene-7-carboxylate |
|---|---|
| PubChem CID | 167706585 |
| Molecular Formula | C32H44N4O6S2 |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | ethyl 2-amino-3-(cyclopropylmethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophene-5-carboxylate;ethyl 2-amino-3-(cyclopropylmethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophene-7-carboxylate |
| SMILES | CCOC(=O)C1CCCc2c1sc(N)c2C(=O)NCC1CC1.CCOC(=O)C1CCc2sc(N)c(C(=O)NCC3CC3)c2C1 |
| InChI | InChI=1S/2C16H22N2O3S/c1-2-21-16(20)10-5-6-12-11(7-10)13(14(17)22-12)15(19)18-8-9-3-4-9;1-2-21-16(20)11-5-3-4-10-12(14(17)22-13(10)11)15(19)18-8-9-6-7-9/h9-10H,2-8,17H2,1H3,(H,18,19);9,11H,2-8,17H2,1H3,(H,18,19) |
| InChIKey | ZEMOUXWLHVXYQC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|