C16H17Cl2NO2 — CID 84612177
6,7-dichloro-9-propyl-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 84612177) has the molecular formula C16H17Cl2NO2 and a molecular weight of 326.22 g/mol. Its IUPAC name is 6,7-dichloro-9-propyl-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | 6,7-dichloro-9-propyl-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 84612177 |
| Molecular Formula | C16H17Cl2NO2 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 6,7-dichloro-9-propyl-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | CCCn1c2c(c3cc(Cl)c(Cl)cc31)CC(C(=O)O)CC2 |
| InChI | InChI=1S/C16H17Cl2NO2/c1-2-5-19-14-4-3-9(16(20)21)6-10(14)11-7-12(17)13(18)8-15(11)19/h7-9H,2-6H2,1H3,(H,20,21) |
| InChIKey | UZOYHRDDKAVSJX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|