C20H17ClNO3P — CID 138717980
9-(4-chlorobenzoyl)-6-phosphanyl-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 138717980) has the molecular formula C20H17ClNO3P and a molecular weight of 385.79 g/mol. Its IUPAC name is 9-(4-chlorobenzoyl)-6-phosphanyl-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | 9-(4-chlorobenzoyl)-6-phosphanyl-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 138717980 |
| Molecular Formula | C20H17ClNO3P |
| Molecular Weight | 385.79 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 9-(4-chlorobenzoyl)-6-phosphanyl-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | O=C(O)C1CCc2c(c3cc(P)ccc3n2C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H17ClNO3P/c21-13-4-1-11(2-5-13)19(23)22-17-7-3-12(20(24)25)9-15(17)16-10-14(26)6-8-18(16)22/h1-2,4-6,8,10,12H,3,7,9,26H2,(H,24,25) |
| InChIKey | HSHIQISMTYVCBR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.79 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|