C28H27NO3 — CID 141445340
9-[(4-methylphenyl)methyl]-6-phenylmethoxy-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 141445340) has the molecular formula C28H27NO3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 9-[(4-methylphenyl)methyl]-6-phenylmethoxy-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | 9-[(4-methylphenyl)methyl]-6-phenylmethoxy-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 141445340 |
| Molecular Formula | C28H27NO3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 9-[(4-methylphenyl)methyl]-6-phenylmethoxy-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | Cc1ccc(Cn2c3c(c4cc(OCc5ccccc5)ccc42)CC(C(=O)O)CC3)cc1 |
| InChI | InChI=1S/C28H27NO3/c1-19-7-9-20(10-8-19)17-29-26-13-11-22(28(30)31)15-24(26)25-16-23(12-14-27(25)29)32-18-21-5-3-2-4-6-21/h2-10,12,14,16,22H,11,13,15,17-18H2,1H3,(H,30,31) |
| InChIKey | FXFIJFPNLGETLD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|