C34H29NO5 — CID 141445334
9-[[4-(2-carboxyphenyl)phenyl]methyl]-6-phenylmethoxy-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid (PubChem CID 141445334) has the molecular formula C34H29NO5 and a molecular weight of 531.61 g/mol. Its IUPAC name is 9-[[4-(2-carboxyphenyl)phenyl]methyl]-6-phenylmethoxy-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid.
| Compound Name | 9-[[4-(2-carboxyphenyl)phenyl]methyl]-6-phenylmethoxy-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 141445334 |
| Molecular Formula | C34H29NO5 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 9-[[4-(2-carboxyphenyl)phenyl]methyl]-6-phenylmethoxy-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccccc1-c1ccc(Cn2c3c(c4cc(OCc5ccccc5)ccc42)CC(C(=O)O)CC3)cc1 |
| InChI | InChI=1S/C34H29NO5/c36-33(37)25-14-16-31-29(18-25)30-19-26(40-21-23-6-2-1-3-7-23)15-17-32(30)35(31)20-22-10-12-24(13-11-22)27-8-4-5-9-28(27)34(38)39/h1-13,15,17,19,25H,14,16,18,20-21H2,(H,36,37)(H,38,39) |
| InChIKey | RWALXONVEZICBF-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|