C24H28N4O3 — CID 19412600
4-[[3-[(4-tert-butylphenoxy)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide (PubChem CID 19412600) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 4-[[3-[(4-tert-butylphenoxy)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-[[3-[(4-tert-butylphenoxy)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19412600 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 4-[[3-[(4-tert-butylphenoxy)methyl]benzoyl]amino]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2cccc(COc3ccc(C(C)(C)C)cc3)c2)c(C(N)=O)n1 |
| InChI | InChI=1S/C24H28N4O3/c1-5-28-14-20(21(27-28)22(25)29)26-23(30)17-8-6-7-16(13-17)15-31-19-11-9-18(10-12-19)24(2,3)4/h6-14H,5,15H2,1-4H3,(H2,25,29)(H,26,30) |
| InChIKey | AXANVAUMQKGMOZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |