C24H27N5O5 — CID 19398428
1-ethyl-4-[[3-[(3-methyl-4-nitrophenoxy)methyl]benzoyl]amino]-N-propylpyrazole-3-carboxamide (PubChem CID 19398428) has the molecular formula C24H27N5O5 and a molecular weight of 465.51 g/mol. Its IUPAC name is 1-ethyl-4-[[3-[(3-methyl-4-nitrophenoxy)methyl]benzoyl]amino]-N-propylpyrazole-3-carboxamide.
| Compound Name | 1-ethyl-4-[[3-[(3-methyl-4-nitrophenoxy)methyl]benzoyl]amino]-N-propylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19398428 |
| Molecular Formula | C24H27N5O5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 1-ethyl-4-[[3-[(3-methyl-4-nitrophenoxy)methyl]benzoyl]amino]-N-propylpyrazole-3-carboxamide |
| SMILES | CCCNC(=O)c1nn(CC)cc1NC(=O)c1cccc(COc2ccc([N+](=O)[O-])c(C)c2)c1 |
| InChI | InChI=1S/C24H27N5O5/c1-4-11-25-24(31)22-20(14-28(5-2)27-22)26-23(30)18-8-6-7-17(13-18)15-34-19-9-10-21(29(32)33)16(3)12-19/h6-10,12-14H,4-5,11,15H2,1-3H3,(H,25,31)(H,26,30) |
| InChIKey | VVFGUWWXKYAVGU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|