C23H25N5O5 — CID 19396344
1-methyl-4-[[3-[(4-methyl-2-nitrophenoxy)methyl]benzoyl]amino]-N-propylpyrazole-5-carboxamide (PubChem CID 19396344) has the molecular formula C23H25N5O5 and a molecular weight of 451.48 g/mol. Its IUPAC name is 1-methyl-4-[[3-[(4-methyl-2-nitrophenoxy)methyl]benzoyl]amino]-N-propylpyrazole-5-carboxamide.
| Compound Name | 1-methyl-4-[[3-[(4-methyl-2-nitrophenoxy)methyl]benzoyl]amino]-N-propylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19396344 |
| Molecular Formula | C23H25N5O5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 1-methyl-4-[[3-[(4-methyl-2-nitrophenoxy)methyl]benzoyl]amino]-N-propylpyrazole-5-carboxamide |
| SMILES | CCCNC(=O)c1c(NC(=O)c2cccc(COc3ccc(C)cc3[N+](=O)[O-])c2)cnn1C |
| InChI | InChI=1S/C23H25N5O5/c1-4-10-24-23(30)21-18(13-25-27(21)3)26-22(29)17-7-5-6-16(12-17)14-33-20-9-8-15(2)11-19(20)28(31)32/h5-9,11-13H,4,10,14H2,1-3H3,(H,24,30)(H,26,29) |
| InChIKey | LYIZMCXWUABFGD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|