C18H17N5O6 — CID 19398087
N-(furan-2-ylmethyl)-4-[(4-methoxy-3-nitrobenzoyl)amino]-1-methylpyrazole-5-carboxamide (PubChem CID 19398087) has the molecular formula C18H17N5O6 and a molecular weight of 399.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-[(4-methoxy-3-nitrobenzoyl)amino]-1-methylpyrazole-5-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-4-[(4-methoxy-3-nitrobenzoyl)amino]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19398087 |
| Molecular Formula | C18H17N5O6 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-[(4-methoxy-3-nitrobenzoyl)amino]-1-methylpyrazole-5-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2cnn(C)c2C(=O)NCc2ccco2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17N5O6/c1-22-16(18(25)19-9-12-4-3-7-29-12)13(10-20-22)21-17(24)11-5-6-15(28-2)14(8-11)23(26)27/h3-8,10H,9H2,1-2H3,(H,19,25)(H,21,24) |
| InChIKey | XYEKZFGBVUSIBV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 141.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|