C17H22N4O4 — CID 19412447
4-[(3,4-diethoxybenzoyl)amino]-1-ethylpyrazole-3-carboxamide (PubChem CID 19412447) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-[(3,4-diethoxybenzoyl)amino]-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-[(3,4-diethoxybenzoyl)amino]-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19412447 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4-[(3,4-diethoxybenzoyl)amino]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCOc1ccc(C(=O)Nc2cn(CC)nc2C(N)=O)cc1OCC |
| InChI | InChI=1S/C17H22N4O4/c1-4-21-10-12(15(20-21)16(18)22)19-17(23)11-7-8-13(24-5-2)14(9-11)25-6-3/h7-10H,4-6H2,1-3H3,(H2,18,22)(H,19,23) |
| InChIKey | KBOVINUQAMWRGO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |