C13H13IN4O2 — CID 19412436
1-ethyl-4-[(2-iodobenzoyl)amino]pyrazole-3-carboxamide (PubChem CID 19412436) has the molecular formula C13H13IN4O2 and a molecular weight of 384.18 g/mol. Its IUPAC name is 1-ethyl-4-[(2-iodobenzoyl)amino]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-4-[(2-iodobenzoyl)amino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19412436 |
| Molecular Formula | C13H13IN4O2 |
| Molecular Weight | 384.18 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 1-ethyl-4-[(2-iodobenzoyl)amino]pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2ccccc2I)c(C(N)=O)n1 |
| InChI | InChI=1S/C13H13IN4O2/c1-2-18-7-10(11(17-18)12(15)19)16-13(20)8-5-3-4-6-9(8)14/h3-7H,2H2,1H3,(H2,15,19)(H,16,20) |
| InChIKey | RDMRTRJCVZRSIN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|