C13H18N6O2 — CID 4772267
1-ethyl-4-[(1-ethyl-5-methylpyrazole-4-carbonyl)amino]pyrazole-3-carboxamide (PubChem CID 4772267) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-ethyl-4-[(1-ethyl-5-methylpyrazole-4-carbonyl)amino]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-4-[(1-ethyl-5-methylpyrazole-4-carbonyl)amino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4772267 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-ethyl-4-[(1-ethyl-5-methylpyrazole-4-carbonyl)amino]pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2cnn(CC)c2C)c(C(N)=O)n1 |
| InChI | InChI=1S/C13H18N6O2/c1-4-18-7-10(11(17-18)12(14)20)16-13(21)9-6-15-19(5-2)8(9)3/h6-7H,4-5H2,1-3H3,(H2,14,20)(H,16,21) |
| InChIKey | FONKIQOBJVKKNL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |