C13H18N6O2 — CID 19281178
1-ethyl-4-[(1-ethylpyrazole-4-carbonyl)amino]-N-methylpyrazole-3-carboxamide (PubChem CID 19281178) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-ethyl-4-[(1-ethylpyrazole-4-carbonyl)amino]-N-methylpyrazole-3-carboxamide.
| Compound Name | 1-ethyl-4-[(1-ethylpyrazole-4-carbonyl)amino]-N-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19281178 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-ethyl-4-[(1-ethylpyrazole-4-carbonyl)amino]-N-methylpyrazole-3-carboxamide |
| SMILES | CCn1cc(C(=O)Nc2cn(CC)nc2C(=O)NC)cn1 |
| InChI | InChI=1S/C13H18N6O2/c1-4-18-7-9(6-15-18)12(20)16-10-8-19(5-2)17-11(10)13(21)14-3/h6-8H,4-5H2,1-3H3,(H,14,21)(H,16,20) |
| InChIKey | VMQWVQLHCWJDJH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |