C13H12N4O2 — CID 71979949
N-(5-cyano-2-hydroxyphenyl)-1-ethylpyrazole-4-carboxamide (PubChem CID 71979949) has the molecular formula C13H12N4O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is N-(5-cyano-2-hydroxyphenyl)-1-ethylpyrazole-4-carboxamide.
| Compound Name | N-(5-cyano-2-hydroxyphenyl)-1-ethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71979949 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-(5-cyano-2-hydroxyphenyl)-1-ethylpyrazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)Nc2cc(C#N)ccc2O)cn1 |
| InChI | InChI=1S/C13H12N4O2/c1-2-17-8-10(7-15-17)13(19)16-11-5-9(6-14)3-4-12(11)18/h3-5,7-8,18H,2H2,1H3,(H,16,19) |
| InChIKey | WYYJUWIZCSCDRL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|