C20H25N3O4 — CID 75397296
N-[2-carbamoyl-4-(dimethylamino)phenyl]-3,4-diethoxybenzamide (PubChem CID 75397296) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[2-carbamoyl-4-(dimethylamino)phenyl]-3,4-diethoxybenzamide.
| Compound Name | N-[2-carbamoyl-4-(dimethylamino)phenyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 75397296 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[2-carbamoyl-4-(dimethylamino)phenyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(N(C)C)cc2C(N)=O)cc1OCC |
| InChI | InChI=1S/C20H25N3O4/c1-5-26-17-10-7-13(11-18(17)27-6-2)20(25)22-16-9-8-14(23(3)4)12-15(16)19(21)24/h7-12H,5-6H2,1-4H3,(H2,21,24)(H,22,25) |
| InChIKey | HWPRDGGOTXHMDC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |