3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid

C16H17NO5S — CID 16776584

IUPAC3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid
SMILESCCOc1ccc(C(=O)Nc2ccsc2C(=O)O)cc1OCC
InChIInChI=1S/C16H17NO5S/c1-3-21-12-6-5-10(9-13(12)22-4-2)15(18)17-11-7-8-23-14(11)16(19)20/h5-9H,3-4H2,1-2H3,(H,17,18)(H,19,20)
InChIKeyCBJRGAXRDFMHRV-UHFFFAOYSA-N
MW335.38 g/mol
LogP3.50
Rot. Bonds7

About 3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid

3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid (PubChem CID 16776584) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is 3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid.

Molecular Properties

Compound Name3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid
PubChem CID16776584
Molecular FormulaC16H17NO5S
Molecular Weight335.38 g/mol
Exact Mass335.08
IUPAC Name3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid
SMILESCCOc1ccc(C(=O)Nc2ccsc2C(=O)O)cc1OCC
InChIInChI=1S/C16H17NO5S/c1-3-21-12-6-5-10(9-13(12)22-4-2)15(18)17-11-7-8-23-14(11)16(19)20/h5-9H,3-4H2,1-2H3,(H,17,18)(H,19,20)
InChIKeyCBJRGAXRDFMHRV-UHFFFAOYSA-N
XLogP3.50
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500335.38
LogP ≤ 53.50
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid?
The IUPAC name of 3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid (CID 16776584) is 3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid.
What is the SMILES notation for 3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid?
The canonical SMILES for 3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid is CCOc1ccc(C(=O)Nc2ccsc2C(=O)O)cc1OCC.
What is the InChIKey of 3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid?
The InChIKey is CBJRGAXRDFMHRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO5S/c1-3-21-12-6-5-10(9-13(12)22-4-2)15(18)17-11-7-8-23-14(11)16(19)20/h5-9H,3-4H2,1-2H3,(H,17,18)(H,19,20).
What are the key properties of 3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid?
3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid has a molecular weight of 335.38 g/mol, XLogP of 3.50, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-diethoxybenzoyl)amino]thiophene-2-carboxylic acid is sourced from PubChem (CID 16776584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).