C16H18O4S — CID 81121511
(3,4-diethoxyphenyl)-(3-methoxythiophen-2-yl)methanone (PubChem CID 81121511) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)-(3-methoxythiophen-2-yl)methanone.
| Compound Name | (3,4-diethoxyphenyl)-(3-methoxythiophen-2-yl)methanone |
|---|---|
| PubChem CID | 81121511 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (3,4-diethoxyphenyl)-(3-methoxythiophen-2-yl)methanone |
| SMILES | CCOc1ccc(C(=O)c2sccc2OC)cc1OCC |
| InChI | InChI=1S/C16H18O4S/c1-4-19-12-7-6-11(10-14(12)20-5-2)15(17)16-13(18-3)8-9-21-16/h6-10H,4-5H2,1-3H3 |
| InChIKey | VVWKUSQFSLOLOB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |