C15H15NO6S — CID 16774257
3-[(3,4,5-trimethoxybenzoyl)amino]thiophene-2-carboxylic acid (PubChem CID 16774257) has the molecular formula C15H15NO6S and a molecular weight of 337.35 g/mol. Its IUPAC name is 3-[(3,4,5-trimethoxybenzoyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 3-[(3,4,5-trimethoxybenzoyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 16774257 |
| Molecular Formula | C15H15NO6S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 3-[(3,4,5-trimethoxybenzoyl)amino]thiophene-2-carboxylic acid |
| SMILES | COc1cc(C(=O)Nc2ccsc2C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C15H15NO6S/c1-20-10-6-8(7-11(21-2)12(10)22-3)14(17)16-9-4-5-23-13(9)15(18)19/h4-7H,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | XGCMLOSSRKEIMN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |