C20H21F4N3O2S — CID 4866990
1-(2-ethylphenyl)-3-[[3-(2,2,3,3-tetrafluoropropoxymethyl)benzoyl]amino]thiourea (PubChem CID 4866990) has the molecular formula C20H21F4N3O2S and a molecular weight of 443.47 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-3-[[3-(2,2,3,3-tetrafluoropropoxymethyl)benzoyl]amino]thiourea.
| Compound Name | 1-(2-ethylphenyl)-3-[[3-(2,2,3,3-tetrafluoropropoxymethyl)benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 4866990 |
| Molecular Formula | C20H21F4N3O2S |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 1-(2-ethylphenyl)-3-[[3-(2,2,3,3-tetrafluoropropoxymethyl)benzoyl]amino]thiourea |
| SMILES | CCc1ccccc1NC(=S)NNC(=O)c1cccc(COCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C20H21F4N3O2S/c1-2-14-7-3-4-9-16(14)25-19(30)27-26-17(28)15-8-5-6-13(10-15)11-29-12-20(23,24)18(21)22/h3-10,18H,2,11-12H2,1H3,(H,26,28)(H2,25,27,30) |
| InChIKey | GTRJKJLXAOQKKV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|