C21H15BrCl2N2O3 — CID 19292124
[(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3-[(4-bromophenoxy)methyl]benzoate (PubChem CID 19292124) has the molecular formula C21H15BrCl2N2O3 and a molecular weight of 494.17 g/mol. Its IUPAC name is [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3-[(4-bromophenoxy)methyl]benzoate.
| Compound Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3-[(4-bromophenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 19292124 |
| Molecular Formula | C21H15BrCl2N2O3 |
| Molecular Weight | 494.17 g/mol |
| Exact Mass | 491.96 |
| IUPAC Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3-[(4-bromophenoxy)methyl]benzoate |
| SMILES | N/C(=N\OC(=O)c1cccc(COc2ccc(Br)cc2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H15BrCl2N2O3/c22-15-4-7-17(8-5-15)28-12-13-2-1-3-14(10-13)21(27)29-26-20(25)18-9-6-16(23)11-19(18)24/h1-11H,12H2,(H2,25,26) |
| InChIKey | NELBIIXVXRSGPR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.17 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|