C22H22Cl2F4N2O2 — CID 19295261
[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanone (PubChem CID 19295261) has the molecular formula C22H22Cl2F4N2O2 and a molecular weight of 493.33 g/mol. Its IUPAC name is [4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanone.
| Compound Name | [4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 19295261 |
| Molecular Formula | C22H22Cl2F4N2O2 |
| Molecular Weight | 493.33 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | [4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(COCC(F)(F)C(F)F)c1)N1CCN(Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C22H22Cl2F4N2O2/c23-18-5-4-17(19(24)11-18)12-29-6-8-30(9-7-29)20(31)16-3-1-2-15(10-16)13-32-14-22(27,28)21(25)26/h1-5,10-11,21H,6-9,12-14H2 |
| InChIKey | PVLQVBNCVVNVMU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.33 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|