C26H21Cl2N3O3 — CID 19295249
2-[3-[4-[(2,4-dichlorophenyl)methyl]piperazine-1-carbonyl]phenyl]isoindole-1,3-dione (PubChem CID 19295249) has the molecular formula C26H21Cl2N3O3 and a molecular weight of 494.38 g/mol. Its IUPAC name is 2-[3-[4-[(2,4-dichlorophenyl)methyl]piperazine-1-carbonyl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-[(2,4-dichlorophenyl)methyl]piperazine-1-carbonyl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19295249 |
| Molecular Formula | C26H21Cl2N3O3 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 2-[3-[4-[(2,4-dichlorophenyl)methyl]piperazine-1-carbonyl]phenyl]isoindole-1,3-dione |
| SMILES | O=C(c1cccc(N2C(=O)c3ccccc3C2=O)c1)N1CCN(Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C26H21Cl2N3O3/c27-19-9-8-18(23(28)15-19)16-29-10-12-30(13-11-29)24(32)17-4-3-5-20(14-17)31-25(33)21-6-1-2-7-22(21)26(31)34/h1-9,14-15H,10-13,16H2 |
| InChIKey | OHDSOKPBNNKBBL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|