C25H16Cl2N4O3 — CID 19345280
N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 19345280) has the molecular formula C25H16Cl2N4O3 and a molecular weight of 491.33 g/mol. Its IUPAC name is N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 19345280 |
| Molecular Formula | C25H16Cl2N4O3 |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | O=C(Nc1ccn(Cc2ccc(Cl)cc2Cl)n1)c1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C25H16Cl2N4O3/c26-17-9-8-16(21(27)13-17)14-30-11-10-22(29-30)28-23(32)15-4-3-5-18(12-15)31-24(33)19-6-1-2-7-20(19)25(31)34/h1-13H,14H2,(H,28,29,32) |
| InChIKey | JXHCFSNDEAGETI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|