C19H17Cl2N3O3 — CID 19345356
N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3,5-dimethoxybenzamide (PubChem CID 19345356) has the molecular formula C19H17Cl2N3O3 and a molecular weight of 406.27 g/mol. Its IUPAC name is N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 19345356 |
| Molecular Formula | C19H17Cl2N3O3 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccn(Cc3ccc(Cl)cc3Cl)n2)c1 |
| InChI | InChI=1S/C19H17Cl2N3O3/c1-26-15-7-13(8-16(10-15)27-2)19(25)22-18-5-6-24(23-18)11-12-3-4-14(20)9-17(12)21/h3-10H,11H2,1-2H3,(H,22,23,25) |
| InChIKey | JXIUQCWACLRFII-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |