C16H14BrN3O4 — CID 19298217
[(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 4-bromobenzoate (PubChem CID 19298217) has the molecular formula C16H14BrN3O4 and a molecular weight of 392.21 g/mol. Its IUPAC name is [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 4-bromobenzoate.
| Compound Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 4-bromobenzoate |
|---|---|
| PubChem CID | 19298217 |
| Molecular Formula | C16H14BrN3O4 |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 4-bromobenzoate |
| SMILES | NC(=O)COc1ccc(/C(N)=N/OC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C16H14BrN3O4/c17-12-5-1-11(2-6-12)16(22)24-20-15(19)10-3-7-13(8-4-10)23-9-14(18)21/h1-8H,9H2,(H2,18,21)(H2,19,20) |
| InChIKey | URJNUTUDDDSSLT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|