C18H19BrN2O3 — CID 2193249
[[amino-(4-bromophenyl)methylidene]amino] 2-(4-propan-2-ylphenoxy)acetate (PubChem CID 2193249) has the molecular formula C18H19BrN2O3 and a molecular weight of 391.27 g/mol. Its IUPAC name is [[amino-(4-bromophenyl)methylidene]amino] 2-(4-propan-2-ylphenoxy)acetate.
| Compound Name | [[amino-(4-bromophenyl)methylidene]amino] 2-(4-propan-2-ylphenoxy)acetate |
|---|---|
| PubChem CID | 2193249 |
| Molecular Formula | C18H19BrN2O3 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | [[amino-(4-bromophenyl)methylidene]amino] 2-(4-propan-2-ylphenoxy)acetate |
| SMILES | CC(C)c1ccc(OCC(=O)ON=C(N)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C18H19BrN2O3/c1-12(2)13-5-9-16(10-6-13)23-11-17(22)24-21-18(20)14-3-7-15(19)8-4-14/h3-10,12H,11H2,1-2H3,(H2,20,21) |
| InChIKey | WXZSSTWWEAYHPK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|