C16H15BrN2O3 — CID 2911615
[[amino-(4-bromophenyl)methylidene]amino] 2-(4-methoxyphenyl)acetate (PubChem CID 2911615) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is [[amino-(4-bromophenyl)methylidene]amino] 2-(4-methoxyphenyl)acetate.
| Compound Name | [[amino-(4-bromophenyl)methylidene]amino] 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 2911615 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | [[amino-(4-bromophenyl)methylidene]amino] 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)ON=C(N)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C16H15BrN2O3/c1-21-14-8-2-11(3-9-14)10-15(20)22-19-16(18)12-4-6-13(17)7-5-12/h2-9H,10H2,1H3,(H2,18,19) |
| InChIKey | SWSCHQUNUKADLM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|