C13H11F6N3O4 — CID 19298416
[(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 3,3,3-trifluoro-2-(trifluoromethyl)propanoate (PubChem CID 19298416) has the molecular formula C13H11F6N3O4 and a molecular weight of 387.24 g/mol. Its IUPAC name is [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 3,3,3-trifluoro-2-(trifluoromethyl)propanoate.
| Compound Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 19298416 |
| Molecular Formula | C13H11F6N3O4 |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
| SMILES | NC(=O)COc1ccc(/C(N)=N/OC(=O)C(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H11F6N3O4/c14-12(15,16)9(13(17,18)19)11(24)26-22-10(21)6-1-3-7(4-2-6)25-5-8(20)23/h1-4,9H,5H2,(H2,20,23)(H2,21,22) |
| InChIKey | GTORQCXAXJLACH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|