C15H16N4O4S3 — CID 19298284
[(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxylate (PubChem CID 19298284) has the molecular formula C15H16N4O4S3 and a molecular weight of 412.52 g/mol. Its IUPAC name is [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxylate.
| Compound Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 19298284 |
| Molecular Formula | C15H16N4O4S3 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | [(Z)-[amino-[4-(2-amino-2-oxoethoxy)phenyl]methylidene]amino] 3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxylate |
| SMILES | CSc1nsc(SC)c1C(=O)O/N=C(\N)c1ccc(OCC(N)=O)cc1 |
| InChI | InChI=1S/C15H16N4O4S3/c1-24-13-11(15(25-2)26-19-13)14(21)23-18-12(17)8-3-5-9(6-4-8)22-7-10(16)20/h3-6H,7H2,1-2H3,(H2,16,20)(H2,17,18) |
| InChIKey | JYBCPTGHAUOKJT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|