C9H11FN2O2 — CID 112608115
2-[2-(aminomethyl)-6-fluorophenoxy]acetamide (PubChem CID 112608115) has the molecular formula C9H11FN2O2 and a molecular weight of 198.20 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-6-fluorophenoxy]acetamide.
| Compound Name | 2-[2-(aminomethyl)-6-fluorophenoxy]acetamide |
|---|---|
| PubChem CID | 112608115 |
| Molecular Formula | C9H11FN2O2 |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-[2-(aminomethyl)-6-fluorophenoxy]acetamide |
| SMILES | NCc1cccc(F)c1OCC(N)=O |
| InChI | InChI=1S/C9H11FN2O2/c10-7-3-1-2-6(4-11)9(7)14-5-8(12)13/h1-3H,4-5,11H2,(H2,12,13) |
| InChIKey | HETJECBXWPLPOC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |