C15H14BrFN2O2 — CID 115952038
2-[2-(aminomethyl)-6-fluorophenoxy]-N-(4-bromophenyl)acetamide (PubChem CID 115952038) has the molecular formula C15H14BrFN2O2 and a molecular weight of 353.19 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-6-fluorophenoxy]-N-(4-bromophenyl)acetamide.
| Compound Name | 2-[2-(aminomethyl)-6-fluorophenoxy]-N-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 115952038 |
| Molecular Formula | C15H14BrFN2O2 |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 2-[2-(aminomethyl)-6-fluorophenoxy]-N-(4-bromophenyl)acetamide |
| SMILES | NCc1cccc(F)c1OCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H14BrFN2O2/c16-11-4-6-12(7-5-11)19-14(20)9-21-15-10(8-18)2-1-3-13(15)17/h1-7H,8-9,18H2,(H,19,20) |
| InChIKey | JPLFWYYUOXBBBH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |