C12H17FN2O3 — CID 112608108
2-[2-(aminomethyl)-6-fluorophenoxy]-N-(2-methoxyethyl)acetamide (PubChem CID 112608108) has the molecular formula C12H17FN2O3 and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-6-fluorophenoxy]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[2-(aminomethyl)-6-fluorophenoxy]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 112608108 |
| Molecular Formula | C12H17FN2O3 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-[2-(aminomethyl)-6-fluorophenoxy]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)COc1c(F)cccc1CN |
| InChI | InChI=1S/C12H17FN2O3/c1-17-6-5-15-11(16)8-18-12-9(7-14)3-2-4-10(12)13/h2-4H,5-8,14H2,1H3,(H,15,16) |
| InChIKey | QHWFUDLVTZIQBB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|