C14H18FN3O3 — CID 115955367
N-(cyanomethyl)-2-[2-fluoro-6-[(2-methoxyethylamino)methyl]phenoxy]acetamide (PubChem CID 115955367) has the molecular formula C14H18FN3O3 and a molecular weight of 295.31 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[2-fluoro-6-[(2-methoxyethylamino)methyl]phenoxy]acetamide.
| Compound Name | N-(cyanomethyl)-2-[2-fluoro-6-[(2-methoxyethylamino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 115955367 |
| Molecular Formula | C14H18FN3O3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-(cyanomethyl)-2-[2-fluoro-6-[(2-methoxyethylamino)methyl]phenoxy]acetamide |
| SMILES | COCCNCc1cccc(F)c1OCC(=O)NCC#N |
| InChI | InChI=1S/C14H18FN3O3/c1-20-8-7-17-9-11-3-2-4-12(15)14(11)21-10-13(19)18-6-5-16/h2-4,17H,6-10H2,1H3,(H,18,19) |
| InChIKey | SEUUQSCCRCEDDB-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|