C14H19N3O3 — CID 63057420
N-(cyanomethyl)-2-[3-[(2-methoxyethylamino)methyl]phenoxy]acetamide (PubChem CID 63057420) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[3-[(2-methoxyethylamino)methyl]phenoxy]acetamide.
| Compound Name | N-(cyanomethyl)-2-[3-[(2-methoxyethylamino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 63057420 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-(cyanomethyl)-2-[3-[(2-methoxyethylamino)methyl]phenoxy]acetamide |
| SMILES | COCCNCc1cccc(OCC(=O)NCC#N)c1 |
| InChI | InChI=1S/C14H19N3O3/c1-19-8-7-16-10-12-3-2-4-13(9-12)20-11-14(18)17-6-5-15/h2-4,9,16H,6-8,10-11H2,1H3,(H,17,18) |
| InChIKey | HYMNLTGRONRBAK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|