C10H12FNO3 — CID 112613129
2-[2-fluoro-6-(hydroxymethyl)phenoxy]-N-methylacetamide (PubChem CID 112613129) has the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. Its IUPAC name is 2-[2-fluoro-6-(hydroxymethyl)phenoxy]-N-methylacetamide.
| Compound Name | 2-[2-fluoro-6-(hydroxymethyl)phenoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 112613129 |
| Molecular Formula | C10H12FNO3 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 2-[2-fluoro-6-(hydroxymethyl)phenoxy]-N-methylacetamide |
| SMILES | CNC(=O)COc1c(F)cccc1CO |
| InChI | InChI=1S/C10H12FNO3/c1-12-9(14)6-15-10-7(5-13)3-2-4-8(10)11/h2-4,13H,5-6H2,1H3,(H,12,14) |
| InChIKey | UMUCQNQMWQNPLY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |