C14H7F5O2 — CID 103603982
1-(3-fluorophenyl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone (PubChem CID 103603982) has the molecular formula C14H7F5O2 and a molecular weight of 302.20 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone.
| Compound Name | 1-(3-fluorophenyl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone |
|---|---|
| PubChem CID | 103603982 |
| Molecular Formula | C14H7F5O2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1-(3-fluorophenyl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone |
| SMILES | O=C(COc1c(F)c(F)cc(F)c1F)c1cccc(F)c1 |
| InChI | InChI=1S/C14H7F5O2/c15-8-3-1-2-7(4-8)11(20)6-21-14-12(18)9(16)5-10(17)13(14)19/h1-5H,6H2 |
| InChIKey | MOGZCCLFLKFKAC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|