C9H7F3N2O3 — CID 112619998
N-(2-amino-2-oxoethoxy)-3,4,5-trifluorobenzamide (PubChem CID 112619998) has the molecular formula C9H7F3N2O3 and a molecular weight of 248.16 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-3,4,5-trifluorobenzamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 112619998 |
| Molecular Formula | C9H7F3N2O3 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-3,4,5-trifluorobenzamide |
| SMILES | NC(=O)CONC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C9H7F3N2O3/c10-5-1-4(2-6(11)8(5)12)9(16)14-17-3-7(13)15/h1-2H,3H2,(H2,13,15)(H,14,16) |
| InChIKey | MXJRIORWKSIERC-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|