C8H8ClN3O3 — CID 103901221
N-(2-amino-2-oxoethoxy)-2-chloropyridine-4-carboxamide (PubChem CID 103901221) has the molecular formula C8H8ClN3O3 and a molecular weight of 229.62 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-2-chloropyridine-4-carboxamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-2-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 103901221 |
| Molecular Formula | C8H8ClN3O3 |
| Molecular Weight | 229.62 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-2-chloropyridine-4-carboxamide |
| SMILES | NC(=O)CONC(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C8H8ClN3O3/c9-6-3-5(1-2-11-6)8(14)12-15-4-7(10)13/h1-3H,4H2,(H2,10,13)(H,12,14) |
| InChIKey | WLMAIELHNUTUKS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.62 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|