About butanamide;2-chloropyridine-4-carboxamide
butanamide;2-chloropyridine-4-carboxamide (PubChem CID 174570819) has the molecular formula C10H14ClN3O2
and a molecular weight of 243.69 g/mol. Its IUPAC name is butanamide;2-chloropyridine-4-carboxamide.
Molecular Properties
| Compound Name | butanamide;2-chloropyridine-4-carboxamide |
| PubChem CID | 174570819 |
| Molecular Formula | C10H14ClN3O2 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | butanamide;2-chloropyridine-4-carboxamide |
| SMILES | CCCC(N)=O.NC(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C6H5ClN2O.C4H9NO/c7-5-3-4(6(8)10)1-2-9-5;1-2-3-4(5)6/h1-3H,(H2,8,10);2-3H2,1H3,(H2,5,6) |
| InChIKey | PVGBSXSXCDXUTR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze butanamide;2-chloropyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanamide;2-chloropyridine-4-carboxamide?
The IUPAC name of butanamide;2-chloropyridine-4-carboxamide (CID 174570819) is butanamide;2-chloropyridine-4-carboxamide.
What is the SMILES notation for butanamide;2-chloropyridine-4-carboxamide?
The canonical SMILES for butanamide;2-chloropyridine-4-carboxamide is CCCC(N)=O.NC(=O)c1ccnc(Cl)c1.
What is the InChIKey of butanamide;2-chloropyridine-4-carboxamide?
The InChIKey is PVGBSXSXCDXUTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN2O.C4H9NO/c7-5-3-4(6(8)10)1-2-9-5;1-2-3-4(5)6/h1-3H,(H2,8,10);2-3H2,1H3,(H2,5,6).
What are the key properties of butanamide;2-chloropyridine-4-carboxamide?
butanamide;2-chloropyridine-4-carboxamide has a molecular weight of 243.69 g/mol, XLogP of 1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanamide;2-chloropyridine-4-carboxamide is sourced from PubChem (CID 174570819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).