C11H10ClN5O2 — CID 47287788
N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-2-chloropyridine-4-carboxamide (PubChem CID 47287788) has the molecular formula C11H10ClN5O2 and a molecular weight of 279.69 g/mol. Its IUPAC name is N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-2-chloropyridine-4-carboxamide.
| Compound Name | N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-2-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 47287788 |
| Molecular Formula | C11H10ClN5O2 |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-2-chloropyridine-4-carboxamide |
| SMILES | NC(=O)Cn1cc(NC(=O)c2ccnc(Cl)c2)cn1 |
| InChI | InChI=1S/C11H10ClN5O2/c12-9-3-7(1-2-14-9)11(19)16-8-4-15-17(5-8)6-10(13)18/h1-5H,6H2,(H2,13,18)(H,16,19) |
| InChIKey | MSXWKISNBAAJNA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|